C11H20F3NO3 — CID 164667442
2-methoxy-N-methyl-N-[2-methyl-1-(2,2,2-trifluoroethoxy)propyl]propanamide (PubChem CID 164667442) has the molecular formula C11H20F3NO3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-methoxy-N-methyl-N-[2-methyl-1-(2,2,2-trifluoroethoxy)propyl]propanamide.
| Compound Name | 2-methoxy-N-methyl-N-[2-methyl-1-(2,2,2-trifluoroethoxy)propyl]propanamide |
|---|---|
| PubChem CID | 164667442 |
| Molecular Formula | C11H20F3NO3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-methoxy-N-methyl-N-[2-methyl-1-(2,2,2-trifluoroethoxy)propyl]propanamide |
| SMILES | COC(C)C(=O)N(C)C(OCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H20F3NO3/c1-7(2)10(18-6-11(12,13)14)15(4)9(16)8(3)17-5/h7-8,10H,6H2,1-5H3 |
| InChIKey | GZYOZIZLJXHBTM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|