C10H19F3N+ — CID 164667452
[(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium (PubChem CID 164667452) has the molecular formula C10H19F3N+ and a molecular weight of 210.26 g/mol. Its IUPAC name is [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium.
| Compound Name | [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium |
|---|---|
| PubChem CID | 164667452 |
| Molecular Formula | C10H19F3N+ |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium |
| SMILES | C[C@H]([NH2+]CC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H18F3N/c1-8(14-7-10(11,12)13)9-5-3-2-4-6-9/h8-9,14H,2-7H2,1H3/p+1/t8-/m0/s1 |
| InChIKey | RBMCLQNJUANIEM-QMMMGPOBSA-O |
| XLogP | 2.08 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |