About [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium
[(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium (PubChem CID 164667452) has the molecular formula C10H19F3N+
and a molecular weight of 210.26 g/mol. Its IUPAC name is [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium.
Molecular Properties
| Compound Name | [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium |
| PubChem CID | 164667452 |
| Molecular Formula | C10H19F3N+ |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium |
| SMILES | C[C@H]([NH2+]CC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H18F3N/c1-8(14-7-10(11,12)13)9-5-3-2-4-6-9/h8-9,14H,2-7H2,1H3/p+1/t8-/m0/s1 |
| InChIKey | RBMCLQNJUANIEM-QMMMGPOBSA-O |
| XLogP | 2.08 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium?
The IUPAC name of [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium (CID 164667452) is [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium.
What is the SMILES notation for [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium?
The canonical SMILES for [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium is C[C@H]([NH2+]CC(F)(F)F)C1CCCCC1.
What is the InChIKey of [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium?
The InChIKey is RBMCLQNJUANIEM-QMMMGPOBSA-O. The full InChI is InChI=1S/C10H18F3N/c1-8(14-7-10(11,12)13)9-5-3-2-4-6-9/h8-9,14H,2-7H2,1H3/p+1/t8-/m0/s1.
What are the key properties of [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium?
[(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium has a molecular weight of 210.26 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-cyclohexylethyl]-(2,2,2-trifluoroethyl)azanium is sourced from PubChem (CID 164667452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).