C33H41NO7 — CID 164667495
tert-butyl N-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]carbamate (PubChem CID 164667495) has the molecular formula C33H41NO7 and a molecular weight of 563.69 g/mol. Its IUPAC name is tert-butyl N-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 164667495 |
| Molecular Formula | C33H41NO7 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | tert-butyl N-[[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]carbamate |
| SMILES | COC1OC(CNC(=O)OC(C)(C)C)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C33H41NO7/c1-33(2,3)41-32(35)34-20-27-28(37-21-24-14-8-5-9-15-24)29(38-22-25-16-10-6-11-17-25)30(31(36-4)40-27)39-23-26-18-12-7-13-19-26/h5-19,27-31H,20-23H2,1-4H3,(H,34,35) |
| InChIKey | RBVWCJXIHMNGAJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |