About CID 164667516
CID 164667516 (PubChem CID 164667516) has the molecular formula C7H11O2
and a molecular weight of 127.16 g/mol.
Molecular Properties
| Compound Name | CID 164667516 |
| PubChem CID | 164667516 |
| Molecular Formula | C7H11O2 |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | — |
| SMILES | COC1[CH]C(=O)CCC1 |
| InChI | InChI=1S/C7H11O2/c1-9-7-4-2-3-6(8)5-7/h5,7H,2-4H2,1H3 |
| InChIKey | VYUBKSMXRUNULN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 164667516 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164667516?
The IUPAC name of CID 164667516 (CID 164667516) is not available.
What is the SMILES notation for CID 164667516?
The canonical SMILES for CID 164667516 is COC1[CH]C(=O)CCC1.
What is the InChIKey of CID 164667516?
The InChIKey is VYUBKSMXRUNULN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11O2/c1-9-7-4-2-3-6(8)5-7/h5,7H,2-4H2,1H3.
What are the key properties of CID 164667516?
CID 164667516 has a molecular weight of 127.16 g/mol, XLogP of 0.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164667516 is sourced from PubChem (CID 164667516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).