C36H22BF10N — CID 164667595
1-[2-bis(2,3,4,5,6-pentafluorophenyl)boranylnaphthalen-1-yl]-N-methyl-N-propan-2-ylnaphthalen-2-amine (PubChem CID 164667595) has the molecular formula C36H22BF10N and a molecular weight of 669.37 g/mol. Its IUPAC name is 1-[2-bis(2,3,4,5,6-pentafluorophenyl)boranylnaphthalen-1-yl]-N-methyl-N-propan-2-ylnaphthalen-2-amine.
| Compound Name | 1-[2-bis(2,3,4,5,6-pentafluorophenyl)boranylnaphthalen-1-yl]-N-methyl-N-propan-2-ylnaphthalen-2-amine |
|---|---|
| PubChem CID | 164667595 |
| Molecular Formula | C36H22BF10N |
| Molecular Weight | 669.37 g/mol |
| Exact Mass | 669.17 |
| IUPAC Name | 1-[2-bis(2,3,4,5,6-pentafluorophenyl)boranylnaphthalen-1-yl]-N-methyl-N-propan-2-ylnaphthalen-2-amine |
| SMILES | CC(C)N(C)c1ccc2ccccc2c1-c1c(B(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)ccc2ccccc12 |
| InChI | InChI=1S/C36H22BF10N/c1-16(2)48(3)22-15-13-18-9-5-7-11-20(18)24(22)23-19-10-6-4-8-17(19)12-14-21(23)37(25-27(38)31(42)35(46)32(43)28(25)39)26-29(40)33(44)36(47)34(45)30(26)41/h4-16H,1-3H3 |
| InChIKey | MNJNPBPGVABIMA-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.37 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|