C6H10BN — CID 164667678
1,3-dimethyl-1-azonia-3-boranuidacyclohexa-2,4,6-triene (PubChem CID 164667678) has the molecular formula C6H10BN and a molecular weight of 106.96 g/mol. Its IUPAC name is 1,3-dimethyl-1-azonia-3-boranuidacyclohexa-2,4,6-triene.
| Compound Name | 1,3-dimethyl-1-azonia-3-boranuidacyclohexa-2,4,6-triene |
|---|---|
| PubChem CID | 164667678 |
| Molecular Formula | C6H10BN |
| Molecular Weight | 106.96 g/mol |
| Exact Mass | 107.09 |
| IUPAC Name | 1,3-dimethyl-1-azonia-3-boranuidacyclohexa-2,4,6-triene |
| SMILES | C[b-]1ccc[n+](C)c1 |
| InChI | InChI=1S/C6H10BN/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3 |
| InChIKey | YPKQGWPGCQFQDE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.96 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|