C25H50O5Si2 — CID 164667810
methyl (Z)-6-[(1S,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopentyl]hex-4-enoate (PubChem CID 164667810) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is methyl (Z)-6-[(1S,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopentyl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(1S,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 164667810 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | methyl (Z)-6-[(1S,2S,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopentyl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@H]1[C@@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O5Si2/c1-24(2,3)31(8,9)29-21-17-22(30-32(10,11)25(4,5)6)20(18-26)19(21)15-13-12-14-16-23(27)28-7/h12-13,19-22,26H,14-18H2,1-11H3/b13-12-/t19-,20+,21-,22+/m0/s1 |
| InChIKey | XWMLZFTZFIMLRK-PQDHPFHGSA-N |
| XLogP | 6.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|