C17H20F13NO3 — CID 164668172
tert-butyl 4-hydroxy-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)piperidine-1-carboxylate (PubChem CID 164668172) has the molecular formula C17H20F13NO3 and a molecular weight of 533.33 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164668172 |
| Molecular Formula | C17H20F13NO3 |
| Molecular Weight | 533.33 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | tert-butyl 4-hydroxy-4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H20F13NO3/c1-10(2,3)34-9(32)31-6-4-11(33,5-7-31)8-12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h33H,4-8H2,1-3H3 |
| InChIKey | RHZBHTQWVIXQPM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|