C19H21NO — CID 164668216
(4S,5R)-2-tert-butyl-4,5-diphenyl-4,5-dihydro-1,3-oxazole (PubChem CID 164668216) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (4S,5R)-2-tert-butyl-4,5-diphenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5R)-2-tert-butyl-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 164668216 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (4S,5R)-2-tert-butyl-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)C1=N[C@@H](c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C19H21NO/c1-19(2,3)18-20-16(14-10-6-4-7-11-14)17(21-18)15-12-8-5-9-13-15/h4-13,16-17H,1-3H3/t16-,17+/m0/s1 |
| InChIKey | JGJZDVPPNZSOIP-DLBZAZTESA-N |
| XLogP | 4.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |