About 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine
1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine (PubChem CID 164668240) has the molecular formula C15H14N2O
and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine.
Molecular Properties
| Compound Name | 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine |
| PubChem CID | 164668240 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine |
| SMILES | CN1/C(=N/c2ccccc2)OCc2ccccc21 |
| InChI | InChI=1S/C15H14N2O/c1-17-14-10-6-5-7-12(14)11-18-15(17)16-13-8-3-2-4-9-13/h2-10H,11H2,1H3/b16-15- |
| InChIKey | MIRPRJFDMHCDOI-NXVVXOECSA-N |
| XLogP | 3.34 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine?
The IUPAC name of 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine (CID 164668240) is 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine.
What is the SMILES notation for 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine?
The canonical SMILES for 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine is CN1/C(=N/c2ccccc2)OCc2ccccc21.
What is the InChIKey of 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine?
The InChIKey is MIRPRJFDMHCDOI-NXVVXOECSA-N. The full InChI is InChI=1S/C15H14N2O/c1-17-14-10-6-5-7-12(14)11-18-15(17)16-13-8-3-2-4-9-13/h2-10H,11H2,1H3/b16-15-.
What are the key properties of 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine?
1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine has a molecular weight of 238.29 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-phenyl-4H-3,1-benzoxazin-2-imine is sourced from PubChem (CID 164668240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).