About (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole
(5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole (PubChem CID 164668254) has the molecular formula C23H21NOS
and a molecular weight of 359.49 g/mol. Its IUPAC name is (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole.
Molecular Properties
| Compound Name | (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole |
| PubChem CID | 164668254 |
| Molecular Formula | C23H21NOS |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole |
| SMILES | Cc1cccc([C@]2(CSc3ccccc3)CC(c3ccccc3)=NO2)c1 |
| InChI | InChI=1S/C23H21NOS/c1-18-9-8-12-20(15-18)23(17-26-21-13-6-3-7-14-21)16-22(24-25-23)19-10-4-2-5-11-19/h2-15H,16-17H2,1H3/t23-/m1/s1 |
| InChIKey | MPUKOUNFJLFLDN-HSZRJFAPSA-N |
| XLogP | 5.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole?
The IUPAC name of (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole (CID 164668254) is (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole.
What is the SMILES notation for (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole?
The canonical SMILES for (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole is Cc1cccc([C@]2(CSc3ccccc3)CC(c3ccccc3)=NO2)c1.
What is the InChIKey of (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole?
The InChIKey is MPUKOUNFJLFLDN-HSZRJFAPSA-N. The full InChI is InChI=1S/C23H21NOS/c1-18-9-8-12-20(15-18)23(17-26-21-13-6-3-7-14-21)16-22(24-25-23)19-10-4-2-5-11-19/h2-15H,16-17H2,1H3/t23-/m1/s1.
What are the key properties of (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole?
(5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole has a molecular weight of 359.49 g/mol, XLogP of 5.81, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(3-methylphenyl)-3-phenyl-5-(phenylsulfanylmethyl)-4H-1,2-oxazole is sourced from PubChem (CID 164668254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).