C30H43NO4Si — CID 164668420
tert-butyl N-[(E,1S,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxo-1,5-diphenylpent-3-enyl]carbamate (PubChem CID 164668420) has the molecular formula C30H43NO4Si and a molecular weight of 509.76 g/mol. Its IUPAC name is tert-butyl N-[(E,1S,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxo-1,5-diphenylpent-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(E,1S,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxo-1,5-diphenylpent-3-enyl]carbamate |
|---|---|
| PubChem CID | 164668420 |
| Molecular Formula | C30H43NO4Si |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | tert-butyl N-[(E,1S,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-5-oxo-1,5-diphenylpent-3-enyl]carbamate |
| SMILES | C/C(=C\[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](NC(=O)OC(C)(C)C)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H43NO4Si/c1-22(27(32)24-18-14-11-15-19-24)20-25(21-34-36(8,9)30(5,6)7)26(23-16-12-10-13-17-23)31-28(33)35-29(2,3)4/h10-20,25-26H,21H2,1-9H3,(H,31,33)/b22-20+/t25-,26-/m1/s1 |
| InChIKey | QLNUOWIFDCZUAR-CKKASIRQSA-N |
| XLogP | 7.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|