C17H22O6 — CID 164668437
(4S,7S)-4-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carbaldehyde (PubChem CID 164668437) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is (4S,7S)-4-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carbaldehyde.
| Compound Name | (4S,7S)-4-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carbaldehyde |
|---|---|
| PubChem CID | 164668437 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (4S,7S)-4-methoxy-2,2-dimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carbaldehyde |
| SMILES | CO[C@H]1OC(C=O)[C@@H](OCc2ccccc2)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C17H22O6/c1-17(2)22-14-13(20-10-11-7-5-4-6-8-11)12(9-18)21-16(19-3)15(14)23-17/h4-9,12-16H,10H2,1-3H3/t12?,13-,14?,15?,16+/m1/s1 |
| InChIKey | XQAOUNXENOFARH-LXOMYOHXSA-N |
| XLogP | 1.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|