C16H28O2 — CID 164668452
(3aS,3bS,4R,5R,6aS,7S,7aS)-5-(hydroxymethyl)-3,3,4,7-tetramethyl-2,3a,4,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalen-3b-ol (PubChem CID 164668452) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (3aS,3bS,4R,5R,6aS,7S,7aS)-5-(hydroxymethyl)-3,3,4,7-tetramethyl-2,3a,4,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalen-3b-ol.
| Compound Name | (3aS,3bS,4R,5R,6aS,7S,7aS)-5-(hydroxymethyl)-3,3,4,7-tetramethyl-2,3a,4,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalen-3b-ol |
|---|---|
| PubChem CID | 164668452 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (3aS,3bS,4R,5R,6aS,7S,7aS)-5-(hydroxymethyl)-3,3,4,7-tetramethyl-2,3a,4,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalen-3b-ol |
| SMILES | C[C@H]1[C@@H]2CCC(C)(C)[C@H]2[C@]2(O)[C@H](C)[C@H](CO)C[C@@H]12 |
| InChI | InChI=1S/C16H28O2/c1-9-12-5-6-15(3,4)14(12)16(18)10(2)11(8-17)7-13(9)16/h9-14,17-18H,5-8H2,1-4H3/t9-,10+,11-,12-,13-,14-,16-/m0/s1 |
| InChIKey | GDHGISPITIOKLI-VRDBZCIASA-N |
| XLogP | 2.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |