About (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane]
(1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane] (PubChem CID 164668462) has the molecular formula C19H20O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane].
Molecular Properties
| Compound Name | (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane] |
| PubChem CID | 164668462 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane] |
| SMILES | COc1ccc([C@@H]2OC3(CCOCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H20O3/c1-20-15-8-6-14(7-9-15)18-16-4-2-3-5-17(16)19(22-18)10-12-21-13-11-19/h2-9,18H,10-13H2,1H3/t18-/m0/s1 |
| InChIKey | MTOAYSNQAUNNMP-SFHVURJKSA-N |
| XLogP | 3.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane]?
The IUPAC name of (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane] (CID 164668462) is (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane].
What is the SMILES notation for (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane]?
The canonical SMILES for (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane] is COc1ccc([C@@H]2OC3(CCOCC3)c3ccccc32)cc1.
What is the InChIKey of (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane]?
The InChIKey is MTOAYSNQAUNNMP-SFHVURJKSA-N. The full InChI is InChI=1S/C19H20O3/c1-20-15-8-6-14(7-9-15)18-16-4-2-3-5-17(16)19(22-18)10-12-21-13-11-19/h2-9,18H,10-13H2,1H3/t18-/m0/s1.
What are the key properties of (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane]?
(1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane] has a molecular weight of 296.37 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4-methoxyphenyl)spiro[1H-2-benzofuran-3,4'-oxane] is sourced from PubChem (CID 164668462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).