C28H33NO8PS+ — CID 164668488
[(2R,4aR,6S,7R,8R,8aR)-6-methoxy-7-[(4-methylphenyl)sulfonylamino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-hydroxy-methyl-phenylphosphanium (PubChem CID 164668488) has the molecular formula C28H33NO8PS+ and a molecular weight of 574.61 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aR)-6-methoxy-7-[(4-methylphenyl)sulfonylamino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-hydroxy-methyl-phenylphosphanium.
| Compound Name | [(2R,4aR,6S,7R,8R,8aR)-6-methoxy-7-[(4-methylphenyl)sulfonylamino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-hydroxy-methyl-phenylphosphanium |
|---|---|
| PubChem CID | 164668488 |
| Molecular Formula | C28H33NO8PS+ |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aR)-6-methoxy-7-[(4-methylphenyl)sulfonylamino]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-hydroxy-methyl-phenylphosphanium |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O[P+](C)(O)c2ccccc2)[C@H]1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H33NO8PS/c1-19-14-16-22(17-15-19)39(31,32)29-24-26(37-38(3,30)21-12-8-5-9-13-21)25-23(35-28(24)33-2)18-34-27(36-25)20-10-6-4-7-11-20/h4-17,23-30H,18H2,1-3H3/q+1/t23-,24-,25-,26-,27-,28+,38?/m1/s1 |
| InChIKey | QPAOBHOSCMBLTO-HSXVJUKWSA-N |
| XLogP | 3.31 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|