C16H24O6S — CID 164668503
methyl 3-[[(3S,12R)-12-methyl-2,5,6-trioxo-oxacyclododec-3-yl]sulfanyl]propanoate (PubChem CID 164668503) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is methyl 3-[[(3S,12R)-12-methyl-2,5,6-trioxo-oxacyclododec-3-yl]sulfanyl]propanoate.
| Compound Name | methyl 3-[[(3S,12R)-12-methyl-2,5,6-trioxo-oxacyclododec-3-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 164668503 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 3-[[(3S,12R)-12-methyl-2,5,6-trioxo-oxacyclododec-3-yl]sulfanyl]propanoate |
| SMILES | COC(=O)CCS[C@H]1CC(=O)C(=O)CCCCC[C@@H](C)OC1=O |
| InChI | InChI=1S/C16H24O6S/c1-11-6-4-3-5-7-12(17)13(18)10-14(16(20)22-11)23-9-8-15(19)21-2/h11,14H,3-10H2,1-2H3/t11-,14+/m1/s1 |
| InChIKey | LHGLJJAJMREPLS-RISCZKNCSA-N |
| XLogP | 2.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|