C18H31NO6Si — CID 164668529
[(1R,2S,5R,6R)-2-acetamido-6-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl] acetate (PubChem CID 164668529) has the molecular formula C18H31NO6Si and a molecular weight of 385.53 g/mol. Its IUPAC name is [(1R,2S,5R,6R)-2-acetamido-6-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,2S,5R,6R)-2-acetamido-6-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 164668529 |
| Molecular Formula | C18H31NO6Si |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [(1R,2S,5R,6R)-2-acetamido-6-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)N[C@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H31NO6Si/c1-11(20)19-14-9-10-15(25-26(7,8)18(4,5)6)17(24-13(3)22)16(14)23-12(2)21/h9-10,14-17H,1-8H3,(H,19,20)/t14-,15+,16+,17-/m0/s1 |
| InChIKey | HVXFQXOAFUIQQD-HZMVEIRTSA-N |
| XLogP | 2.31 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|