C21H26O6 — CID 164668581
(1S,9S)-1,9-dihydroxy-4-[(2S)-2-hydroxy-4-methylpent-3-enoyl]-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione (PubChem CID 164668581) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (1S,9S)-1,9-dihydroxy-4-[(2S)-2-hydroxy-4-methylpent-3-enoyl]-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione.
| Compound Name | (1S,9S)-1,9-dihydroxy-4-[(2S)-2-hydroxy-4-methylpent-3-enoyl]-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione |
|---|---|
| PubChem CID | 164668581 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1S,9S)-1,9-dihydroxy-4-[(2S)-2-hydroxy-4-methylpent-3-enoyl]-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione |
| SMILES | CC(C)=C[C@H](O)C(=O)C1(C)C2=C(C(=O)C=CC2=O)C(O)C2C1CC[C@]2(C)O |
| InChI | InChI=1S/C21H26O6/c1-10(2)9-14(24)19(26)21(4)11-7-8-20(3,27)16(11)18(25)15-12(22)5-6-13(23)17(15)21/h5-6,9,11,14,16,18,24-25,27H,7-8H2,1-4H3/t11?,14-,16?,18?,20-,21?/m0/s1 |
| InChIKey | MYBKFRSLRFZUSC-FTIPLAGJSA-N |
| XLogP | 1.05 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|