C21H26O5 — CID 164668583
(1S,9aR)-1-hydroxy-4-[(2S)-2-hydroxy-4-methylpent-3-enoyl]-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione (PubChem CID 164668583) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (1S,9aR)-1-hydroxy-4-[(2S)-2-hydroxy-4-methylpent-3-enoyl]-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione.
| Compound Name | (1S,9aR)-1-hydroxy-4-[(2S)-2-hydroxy-4-methylpent-3-enoyl]-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione |
|---|---|
| PubChem CID | 164668583 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1S,9aR)-1-hydroxy-4-[(2S)-2-hydroxy-4-methylpent-3-enoyl]-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione |
| SMILES | CC(C)=C[C@H](O)C(=O)C1(C)C2=C(C[C@@H]3C1CC[C@]3(C)O)C(=O)C=CC2=O |
| InChI | InChI=1S/C21H26O5/c1-11(2)9-17(24)19(25)21(4)13-7-8-20(3,26)14(13)10-12-15(22)5-6-16(23)18(12)21/h5-6,9,13-14,17,24,26H,7-8,10H2,1-4H3/t13?,14-,17+,20+,21?/m1/s1 |
| InChIKey | NNNSDFSKMCEKPH-KJTQNSENSA-N |
| XLogP | 2.07 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|