C14H28O3Si — CID 164668678
(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-5-yne-2,3-diol (PubChem CID 164668678) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-5-yne-2,3-diol.
| Compound Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-5-yne-2,3-diol |
|---|---|
| PubChem CID | 164668678 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-5-yne-2,3-diol |
| SMILES | C#CC(C)(C)[C@@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-9-14(5,6)12(16)11(15)10-17-18(7,8)13(2,3)4/h1,11-12,15-16H,10H2,2-8H3/t11-,12+/m1/s1 |
| InChIKey | FHDUPTJOFFSPPI-NEPJUHHUSA-N |
| XLogP | 2.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|