C26H26O5S — CID 164668715
(6S,8aS)-2-phenyl-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 164668715) has the molecular formula C26H26O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is (6S,8aS)-2-phenyl-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (6S,8aS)-2-phenyl-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 164668715 |
| Molecular Formula | C26H26O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (6S,8aS)-2-phenyl-7-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | OC1C(OCc2ccccc2)[C@H](Sc2ccccc2)OC2COC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C26H26O5S/c27-22-23-21(17-29-25(31-23)19-12-6-2-7-13-19)30-26(32-20-14-8-3-9-15-20)24(22)28-16-18-10-4-1-5-11-18/h1-15,21-27H,16-17H2/t21?,22?,23-,24?,25?,26+/m1/s1 |
| InChIKey | KTCPAWJLRDXRRC-RRZWLGRWSA-N |
| XLogP | 4.56 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |