C24H48N4O2 — CID 164668828
(3S,6S)-3,6-bis[4-(dipropylamino)butyl]piperazine-2,5-dione (PubChem CID 164668828) has the molecular formula C24H48N4O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is (3S,6S)-3,6-bis[4-(dipropylamino)butyl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-bis[4-(dipropylamino)butyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 164668828 |
| Molecular Formula | C24H48N4O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.38 |
| IUPAC Name | (3S,6S)-3,6-bis[4-(dipropylamino)butyl]piperazine-2,5-dione |
| SMILES | CCCN(CCC)CCCC[C@@H]1NC(=O)[C@H](CCCCN(CCC)CCC)NC1=O |
| InChI | InChI=1S/C24H48N4O2/c1-5-15-27(16-6-2)19-11-9-13-21-23(29)26-22(24(30)25-21)14-10-12-20-28(17-7-3)18-8-4/h21-22H,5-20H2,1-4H3,(H,25,30)(H,26,29)/t21-,22-/m0/s1 |
| InChIKey | VUSYGOHWPYYLLV-VXKWHMMOSA-N |
| XLogP | 3.55 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|