About (Z)-2,4-dicyanopent-3-en-2-olate
(Z)-2,4-dicyanopent-3-en-2-olate (PubChem CID 164668831) has the molecular formula C7H7N2O-
and a molecular weight of 135.15 g/mol. Its IUPAC name is (Z)-2,4-dicyanopent-3-en-2-olate.
Molecular Properties
| Compound Name | (Z)-2,4-dicyanopent-3-en-2-olate |
| PubChem CID | 164668831 |
| Molecular Formula | C7H7N2O- |
| Molecular Weight | 135.15 g/mol |
| Exact Mass | 135.06 |
| IUPAC Name | (Z)-2,4-dicyanopent-3-en-2-olate |
| SMILES | C/C(C#N)=C/C(C)([O-])C#N |
| InChI | InChI=1S/C7H7N2O/c1-6(4-8)3-7(2,10)5-9/h3H,1-2H3/q-1/b6-3- |
| InChIKey | MCTTYUWZAARXQT-UTCJRWHESA-N |
| XLogP | 0.10 |
| TPSA | 70.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,4-dicyanopent-3-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,4-dicyanopent-3-en-2-olate?
The IUPAC name of (Z)-2,4-dicyanopent-3-en-2-olate (CID 164668831) is (Z)-2,4-dicyanopent-3-en-2-olate.
What is the SMILES notation for (Z)-2,4-dicyanopent-3-en-2-olate?
The canonical SMILES for (Z)-2,4-dicyanopent-3-en-2-olate is C/C(C#N)=C/C(C)([O-])C#N.
What is the InChIKey of (Z)-2,4-dicyanopent-3-en-2-olate?
The InChIKey is MCTTYUWZAARXQT-UTCJRWHESA-N. The full InChI is InChI=1S/C7H7N2O/c1-6(4-8)3-7(2,10)5-9/h3H,1-2H3/q-1/b6-3-.
What are the key properties of (Z)-2,4-dicyanopent-3-en-2-olate?
(Z)-2,4-dicyanopent-3-en-2-olate has a molecular weight of 135.15 g/mol, XLogP of 0.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,4-dicyanopent-3-en-2-olate is sourced from PubChem (CID 164668831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).