C44H68O5SSi2 — CID 164668925
[(3R,6S)-5-phenylmethoxy-2-(phenylmethoxymethyl)-6-phenylsulfanyl-3-tri(propan-2-yl)silyloxyoxan-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 164668925) has the molecular formula C44H68O5SSi2 and a molecular weight of 765.26 g/mol. Its IUPAC name is [(3R,6S)-5-phenylmethoxy-2-(phenylmethoxymethyl)-6-phenylsulfanyl-3-tri(propan-2-yl)silyloxyoxan-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3R,6S)-5-phenylmethoxy-2-(phenylmethoxymethyl)-6-phenylsulfanyl-3-tri(propan-2-yl)silyloxyoxan-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 164668925 |
| Molecular Formula | C44H68O5SSi2 |
| Molecular Weight | 765.26 g/mol |
| Exact Mass | 764.43 |
| IUPAC Name | [(3R,6S)-5-phenylmethoxy-2-(phenylmethoxymethyl)-6-phenylsulfanyl-3-tri(propan-2-yl)silyloxyoxan-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC1C(OCc2ccccc2)[C@H](Sc2ccccc2)OC(COCc2ccccc2)[C@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C44H68O5SSi2/c1-31(2)51(32(3)4,33(5)6)48-41-40(30-45-28-37-22-16-13-17-23-37)47-44(50-39-26-20-15-21-27-39)43(46-29-38-24-18-14-19-25-38)42(41)49-52(34(7)8,35(9)10)36(11)12/h13-27,31-36,40-44H,28-30H2,1-12H3/t40?,41-,42?,43?,44+/m1/s1 |
| InChIKey | ZSDSRPXVMCVWOU-WTAOGZEZSA-N |
| XLogP | 12.43 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.26 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|