C19H24O7S — CID 164668934
[(4R,7S)-7-acetyloxy-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl acetate (PubChem CID 164668934) has the molecular formula C19H24O7S and a molecular weight of 396.46 g/mol. Its IUPAC name is [(4R,7S)-7-acetyloxy-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl acetate.
| Compound Name | [(4R,7S)-7-acetyloxy-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 164668934 |
| Molecular Formula | C19H24O7S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [(4R,7S)-7-acetyloxy-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2ccccc2)C2OC(C)(C)OC2[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H24O7S/c1-11(20)22-10-14-15(23-12(2)21)16-17(26-19(3,4)25-16)18(24-14)27-13-8-6-5-7-9-13/h5-9,14-18H,10H2,1-4H3/t14?,15-,16?,17?,18+/m0/s1 |
| InChIKey | UJDINYGUSSUPEY-HHPKQZIOSA-N |
| XLogP | 2.52 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |