C22H31NO2 — CID 164668991
(2S)-2-(2-methylpropyl)-4-(2,3,6-trimethyl-1,2,4a,5,8,8a-hexahydronaphthalene-1-carbonyl)-1,2-dihydropyrrol-5-one (PubChem CID 164668991) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (2S)-2-(2-methylpropyl)-4-(2,3,6-trimethyl-1,2,4a,5,8,8a-hexahydronaphthalene-1-carbonyl)-1,2-dihydropyrrol-5-one.
| Compound Name | (2S)-2-(2-methylpropyl)-4-(2,3,6-trimethyl-1,2,4a,5,8,8a-hexahydronaphthalene-1-carbonyl)-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 164668991 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (2S)-2-(2-methylpropyl)-4-(2,3,6-trimethyl-1,2,4a,5,8,8a-hexahydronaphthalene-1-carbonyl)-1,2-dihydropyrrol-5-one |
| SMILES | CC1=CCC2C(C=C(C)C(C)C2C(=O)C2=C[C@H](CC(C)C)NC2=O)C1 |
| InChI | InChI=1S/C22H31NO2/c1-12(2)8-17-11-19(22(25)23-17)21(24)20-15(5)14(4)10-16-9-13(3)6-7-18(16)20/h6,10-12,15-18,20H,7-9H2,1-5H3,(H,23,25)/t15?,16?,17-,18?,20?/m0/s1 |
| InChIKey | BLKZMLMVFXTMLW-CXJCBYFBSA-N |
| XLogP | 4.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|