C16H27F3O3SSi2 — CID 164669166
[2-[tert-butyl(dimethyl)silyl]-6-trimethylsilylphenyl] trifluoromethanesulfonate (PubChem CID 164669166) has the molecular formula C16H27F3O3SSi2 and a molecular weight of 412.62 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]-6-trimethylsilylphenyl] trifluoromethanesulfonate.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]-6-trimethylsilylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164669166 |
| Molecular Formula | C16H27F3O3SSi2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]-6-trimethylsilylphenyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)c1cccc([Si](C)(C)C)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H27F3O3SSi2/c1-15(2,3)25(7,8)13-11-9-10-12(24(4,5)6)14(13)22-23(20,21)16(17,18)19/h9-11H,1-8H3 |
| InChIKey | DLPMYKZWDCEINK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|