About (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol
(10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol (PubChem CID 164669241) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol.
Molecular Properties
| Compound Name | (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol |
| PubChem CID | 164669241 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol |
| SMILES | C=C[C@H](CC(C)C)[C@H](O)CCCCCCCCCO |
| InChI | InChI=1S/C17H34O2/c1-4-16(14-15(2)3)17(19)12-10-8-6-5-7-9-11-13-18/h4,15-19H,1,5-14H2,2-3H3/t16-,17-/m1/s1 |
| InChIKey | JPJWWEKYVRSAME-IAGOWNOFSA-N |
| XLogP | 4.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol?
The IUPAC name of (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol (CID 164669241) is (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol.
What is the SMILES notation for (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol?
The canonical SMILES for (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol is C=C[C@H](CC(C)C)[C@H](O)CCCCCCCCCO.
What is the InChIKey of (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol?
The InChIKey is JPJWWEKYVRSAME-IAGOWNOFSA-N. The full InChI is InChI=1S/C17H34O2/c1-4-16(14-15(2)3)17(19)12-10-8-6-5-7-9-11-13-18/h4,15-19H,1,5-14H2,2-3H3/t16-,17-/m1/s1.
What are the key properties of (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol?
(10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol has a molecular weight of 270.46 g/mol, XLogP of 4.31, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (10R,11S)-11-ethenyl-13-methyltetradecane-1,10-diol is sourced from PubChem (CID 164669241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).