C33H24N10 — CID 164669285
1,4,7-tris(1-phenyltriazol-4-yl)-10-azatricyclo[5.2.1.04,10]deca-2,5,8-triene (PubChem CID 164669285) has the molecular formula C33H24N10 and a molecular weight of 560.63 g/mol. Its IUPAC name is 1,4,7-tris(1-phenyltriazol-4-yl)-10-azatricyclo[5.2.1.04,10]deca-2,5,8-triene.
| Compound Name | 1,4,7-tris(1-phenyltriazol-4-yl)-10-azatricyclo[5.2.1.04,10]deca-2,5,8-triene |
|---|---|
| PubChem CID | 164669285 |
| Molecular Formula | C33H24N10 |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 1,4,7-tris(1-phenyltriazol-4-yl)-10-azatricyclo[5.2.1.04,10]deca-2,5,8-triene |
| SMILES | C1=CC2(c3cn(-c4ccccc4)nn3)C=CC3(c4cn(-c5ccccc5)nn4)C=CC1(c1cn(-c4ccccc4)nn1)N23 |
| InChI | InChI=1S/C33H24N10/c1-4-10-25(11-5-1)40-22-28(34-37-40)31-16-18-32(29-23-41(38-35-29)26-12-6-2-7-13-26)20-21-33(19-17-31,43(31)32)30-24-42(39-36-30)27-14-8-3-9-15-27/h1-24H |
| InChIKey | BWFMQHBNLYFTRI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|