C12H17F5O — CID 164669326
2-[(E)-9,9,10,10,10-pentafluorodec-6-enyl]oxirane (PubChem CID 164669326) has the molecular formula C12H17F5O and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-[(E)-9,9,10,10,10-pentafluorodec-6-enyl]oxirane.
| Compound Name | 2-[(E)-9,9,10,10,10-pentafluorodec-6-enyl]oxirane |
|---|---|
| PubChem CID | 164669326 |
| Molecular Formula | C12H17F5O |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[(E)-9,9,10,10,10-pentafluorodec-6-enyl]oxirane |
| SMILES | FC(F)(F)C(F)(F)C/C=C/CCCCCC1CO1 |
| InChI | InChI=1S/C12H17F5O/c13-11(14,12(15,16)17)8-6-4-2-1-3-5-7-10-9-18-10/h4,6,10H,1-3,5,7-9H2/b6-4+ |
| InChIKey | KYVBCSCINVBMTR-GQCTYLIASA-N |
| XLogP | 4.48 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|