C12H18O2 — CID 164669654
methyl (3R,6R)-6-methyl-3-prop-1-en-2-ylcyclohexene-1-carboxylate (PubChem CID 164669654) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is methyl (3R,6R)-6-methyl-3-prop-1-en-2-ylcyclohexene-1-carboxylate.
| Compound Name | methyl (3R,6R)-6-methyl-3-prop-1-en-2-ylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 164669654 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | methyl (3R,6R)-6-methyl-3-prop-1-en-2-ylcyclohexene-1-carboxylate |
| SMILES | C=C(C)[C@H]1C=C(C(=O)OC)[C@H](C)CC1 |
| InChI | InChI=1S/C12H18O2/c1-8(2)10-6-5-9(3)11(7-10)12(13)14-4/h7,9-10H,1,5-6H2,2-4H3/t9-,10-/m1/s1 |
| InChIKey | SGGNSLFNVICQOG-NXEZZACHSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|