C18H25F5O3 — CID 164669871
3-[1-[2-(4,4,5,5,5-pentafluoropentoxy)ethoxy]ethoxy]propylbenzene (PubChem CID 164669871) has the molecular formula C18H25F5O3 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-[1-[2-(4,4,5,5,5-pentafluoropentoxy)ethoxy]ethoxy]propylbenzene.
| Compound Name | 3-[1-[2-(4,4,5,5,5-pentafluoropentoxy)ethoxy]ethoxy]propylbenzene |
|---|---|
| PubChem CID | 164669871 |
| Molecular Formula | C18H25F5O3 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-[1-[2-(4,4,5,5,5-pentafluoropentoxy)ethoxy]ethoxy]propylbenzene |
| SMILES | CC(OCCCc1ccccc1)OCCOCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H25F5O3/c1-15(25-12-5-9-16-7-3-2-4-8-16)26-14-13-24-11-6-10-17(19,20)18(21,22)23/h2-4,7-8,15H,5-6,9-14H2,1H3 |
| InChIKey | AOBKJXMENBYZGH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|