C17H21NO4 — CID 164669959
ethyl (1S,2S)-2-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylate (PubChem CID 164669959) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl (1S,2S)-2-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,2S)-2-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 164669959 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | ethyl (1S,2S)-2-(phenylmethoxycarbonylamino)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC=C[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-2-21-16(19)14-10-6-7-11-15(14)18-17(20)22-12-13-8-4-3-5-9-13/h3-5,7-9,11,14-15H,2,6,10,12H2,1H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | RRWUXGWNJZJVPS-GJZGRUSLSA-N |
| XLogP | 2.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|