C24H52O6Si2 — CID 164669996
(1R)-1-[(2S,5R)-5-hydroxy-3,4-bis[tri(propan-2-yl)silyloxy]oxolan-2-yl]ethane-1,2-diol (PubChem CID 164669996) has the molecular formula C24H52O6Si2 and a molecular weight of 492.85 g/mol. Its IUPAC name is (1R)-1-[(2S,5R)-5-hydroxy-3,4-bis[tri(propan-2-yl)silyloxy]oxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S,5R)-5-hydroxy-3,4-bis[tri(propan-2-yl)silyloxy]oxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 164669996 |
| Molecular Formula | C24H52O6Si2 |
| Molecular Weight | 492.85 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | (1R)-1-[(2S,5R)-5-hydroxy-3,4-bis[tri(propan-2-yl)silyloxy]oxolan-2-yl]ethane-1,2-diol |
| SMILES | CC(C)[Si](OC1C(O[Si](C(C)C)(C(C)C)C(C)C)[C@H]([C@H](O)CO)O[C@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H52O6Si2/c1-14(2)31(15(3)4,16(5)6)29-22-21(20(26)13-25)28-24(27)23(22)30-32(17(7)8,18(9)10)19(11)12/h14-27H,13H2,1-12H3/t20-,21+,22?,23?,24-/m1/s1 |
| InChIKey | FNFJXMAHLQYUIR-WGHYSAMFSA-N |
| XLogP | 5.18 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.85 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|