C27H31NO4 — CID 164670029
ethyl (5Z,6S,7S,7aS)-5-ethylidene-6,7-bis(phenylmethoxy)-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate (PubChem CID 164670029) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl (5Z,6S,7S,7aS)-5-ethylidene-6,7-bis(phenylmethoxy)-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate.
| Compound Name | ethyl (5Z,6S,7S,7aS)-5-ethylidene-6,7-bis(phenylmethoxy)-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 164670029 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | ethyl (5Z,6S,7S,7aS)-5-ethylidene-6,7-bis(phenylmethoxy)-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate |
| SMILES | C/C=C1/C2=CCCN(C(=O)OCC)[C@@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H31NO4/c1-3-22-23-16-11-17-28(27(29)30-4-2)24(23)26(32-19-21-14-9-6-10-15-21)25(22)31-18-20-12-7-5-8-13-20/h3,5-10,12-16,24-26H,4,11,17-19H2,1-2H3/b22-3-/t24-,25-,26-/m0/s1 |
| InChIKey | MMYPOXMFSUFWQX-VKOAFFOCSA-N |
| XLogP | 5.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |