C18H17FO3 — CID 164670038
methyl (2R,3R,4R)-4-fluoro-5-oxo-2,3-diphenylpentanoate (PubChem CID 164670038) has the molecular formula C18H17FO3 and a molecular weight of 300.33 g/mol. Its IUPAC name is methyl (2R,3R,4R)-4-fluoro-5-oxo-2,3-diphenylpentanoate.
| Compound Name | methyl (2R,3R,4R)-4-fluoro-5-oxo-2,3-diphenylpentanoate |
|---|---|
| PubChem CID | 164670038 |
| Molecular Formula | C18H17FO3 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | methyl (2R,3R,4R)-4-fluoro-5-oxo-2,3-diphenylpentanoate |
| SMILES | COC(=O)[C@@H](c1ccccc1)[C@H](c1ccccc1)[C@@H](F)C=O |
| InChI | InChI=1S/C18H17FO3/c1-22-18(21)17(14-10-6-3-7-11-14)16(15(19)12-20)13-8-4-2-5-9-13/h2-12,15-17H,1H3/t15-,16+,17-/m0/s1 |
| InChIKey | SUOSLVMPXRZQCZ-BBWFWOEESA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|