About methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate
methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate (PubChem CID 164670322) has the molecular formula C26H17N3O6
and a molecular weight of 467.44 g/mol. Its IUPAC name is methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate |
| PubChem CID | 164670322 |
| Molecular Formula | C26H17N3O6 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(-c2nc(C(=O)OC)nnc2-c2cc(=O)oc3c2ccc2ccccc23)cc1 |
| InChI | InChI=1S/C26H17N3O6/c1-33-25(31)16-9-7-15(8-10-16)21-22(28-29-24(27-21)26(32)34-2)19-13-20(30)35-23-17-6-4-3-5-14(17)11-12-18(19)23/h3-13H,1-2H3 |
| InChIKey | ARBVGMJUDVSBLP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 121.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate?
The IUPAC name of methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate (CID 164670322) is methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate.
What is the SMILES notation for methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate?
The canonical SMILES for methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate is COC(=O)c1ccc(-c2nc(C(=O)OC)nnc2-c2cc(=O)oc3c2ccc2ccccc23)cc1.
What is the InChIKey of methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate?
The InChIKey is ARBVGMJUDVSBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17N3O6/c1-33-25(31)16-9-7-15(8-10-16)21-22(28-29-24(27-21)26(32)34-2)19-13-20(30)35-23-17-6-4-3-5-14(17)11-12-18(19)23/h3-13H,1-2H3.
What are the key properties of methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate?
methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate has a molecular weight of 467.44 g/mol, XLogP of 4.04, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4-methoxycarbonylphenyl)-6-(2-oxobenzo[h]chromen-4-yl)-1,2,4-triazine-3-carboxylate is sourced from PubChem (CID 164670322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).