About (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol
(2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol (PubChem CID 164670396) has the molecular formula C8H9F3OS
and a molecular weight of 210.22 g/mol. Its IUPAC name is (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol.
Molecular Properties
| Compound Name | (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol |
| PubChem CID | 164670396 |
| Molecular Formula | C8H9F3OS |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol |
| SMILES | C[C@](O)(CC(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C8H9F3OS/c1-7(12,5-8(9,10)11)6-3-2-4-13-6/h2-4,12H,5H2,1H3/t7-/m0/s1 |
| InChIKey | MGNUGAQRUDEBNM-ZETCQYMHSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol?
The IUPAC name of (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol (CID 164670396) is (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol.
What is the SMILES notation for (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol?
The canonical SMILES for (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol is C[C@](O)(CC(F)(F)F)c1cccs1.
What is the InChIKey of (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol?
The InChIKey is MGNUGAQRUDEBNM-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H9F3OS/c1-7(12,5-8(9,10)11)6-3-2-4-13-6/h2-4,12H,5H2,1H3/t7-/m0/s1.
What are the key properties of (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol?
(2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol has a molecular weight of 210.22 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,4,4-trifluoro-2-thiophen-2-ylbutan-2-ol is sourced from PubChem (CID 164670396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).