C20H22O2 — CID 164670489
2-[(2-ethenylphenyl)methyl]-5,5-dimethyl-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 164670489) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-[(2-ethenylphenyl)methyl]-5,5-dimethyl-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | 2-[(2-ethenylphenyl)methyl]-5,5-dimethyl-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 164670489 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[(2-ethenylphenyl)methyl]-5,5-dimethyl-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | C=Cc1ccccc1CC12C(=O)OC(C)(C)C1C1C=CC2C1 |
| InChI | InChI=1S/C20H22O2/c1-4-13-7-5-6-8-15(13)12-20-16-10-9-14(11-16)17(20)19(2,3)22-18(20)21/h4-10,14,16-17H,1,11-12H2,2-3H3 |
| InChIKey | NHUYTSHRNCORMK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|