About 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one
3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one (PubChem CID 164670558) has the molecular formula C15H13N3O4
and a molecular weight of 299.29 g/mol. Its IUPAC name is 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one.
Molecular Properties
| Compound Name | 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one |
| PubChem CID | 164670558 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one |
| SMILES | CCCNc1nc2oc3ccccc3c(=O)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O4/c1-2-7-16-14-11(18(20)21)8-10-13(19)9-5-3-4-6-12(9)22-15(10)17-14/h3-6,8H,2,7H2,1H3,(H,16,17) |
| InChIKey | PFFJIXUPSHXGCP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one?
The IUPAC name of 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one (CID 164670558) is 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one.
What is the SMILES notation for 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one?
The canonical SMILES for 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one is CCCNc1nc2oc3ccccc3c(=O)c2cc1[N+](=O)[O-].
What is the InChIKey of 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one?
The InChIKey is PFFJIXUPSHXGCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O4/c1-2-7-16-14-11(18(20)21)8-10-13(19)9-5-3-4-6-12(9)22-15(10)17-14/h3-6,8H,2,7H2,1H3,(H,16,17).
What are the key properties of 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one?
3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one has a molecular weight of 299.29 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-2-(propylamino)chromeno[2,3-b]pyridin-5-one is sourced from PubChem (CID 164670558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).