About 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one
1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one (PubChem CID 164670695) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one.
Molecular Properties
| Compound Name | 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one |
| PubChem CID | 164670695 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one |
| SMILES | COC1=CC(=O)C(C)(C)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H19NO2/c1-15(2)14(17)9-13(18-3)11-16(15)10-12-7-5-4-6-8-12/h4-9H,10-11H2,1-3H3 |
| InChIKey | YIIOTIQHJMAPMP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one?
The IUPAC name of 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one (CID 164670695) is 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one.
What is the SMILES notation for 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one?
The canonical SMILES for 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one is COC1=CC(=O)C(C)(C)N(Cc2ccccc2)C1.
What is the InChIKey of 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one?
The InChIKey is YIIOTIQHJMAPMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-15(2)14(17)9-13(18-3)11-16(15)10-12-7-5-4-6-8-12/h4-9H,10-11H2,1-3H3.
What are the key properties of 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one?
1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one has a molecular weight of 245.32 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-methoxy-6,6-dimethyl-2H-pyridin-5-one is sourced from PubChem (CID 164670695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).