C20H36O4Si — CID 164670772
(4S)-4-[(1R,2E,4S,5Z)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,5-dienyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 164670772) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (4S)-4-[(1R,2E,4S,5Z)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,5-dienyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S)-4-[(1R,2E,4S,5Z)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,5-dienyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 164670772 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (4S)-4-[(1R,2E,4S,5Z)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-2,5-dienyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | C/C=C\[C@H](C)/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@]1(C=O)COC(C)(C)O1 |
| InChI | InChI=1S/C20H36O4Si/c1-10-11-16(2)12-13-17(23-25(8,9)18(3,4)5)20(14-21)15-22-19(6,7)24-20/h10-14,16-17H,15H2,1-9H3/b11-10-,13-12+/t16-,17+,20-/m0/s1 |
| InChIKey | DIYPVTGAPLDGQL-NLNUSNJOSA-N |
| XLogP | 4.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|