About 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one
3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one (PubChem CID 164670804) has the molecular formula C14H18NO3+
and a molecular weight of 248.30 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one.
Molecular Properties
| Compound Name | 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one |
| PubChem CID | 164670804 |
| Molecular Formula | C14H18NO3+ |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one |
| SMILES | C[N+]1=C2C=CC=CC2C(C)(CC2OCCO2)C1=O |
| InChI | InChI=1S/C14H18NO3/c1-14(9-12-17-7-8-18-12)10-5-3-4-6-11(10)15(2)13(14)16/h3-6,10,12H,7-9H2,1-2H3/q+1 |
| InChIKey | JZHDUDZQQIYIOV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one?
The IUPAC name of 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one (CID 164670804) is 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one.
What is the SMILES notation for 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one?
The canonical SMILES for 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one is C[N+]1=C2C=CC=CC2C(C)(CC2OCCO2)C1=O.
What is the InChIKey of 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one?
The InChIKey is JZHDUDZQQIYIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18NO3/c1-14(9-12-17-7-8-18-12)10-5-3-4-6-11(10)15(2)13(14)16/h3-6,10,12H,7-9H2,1-2H3/q+1.
What are the key properties of 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one?
3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one has a molecular weight of 248.30 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxolan-2-ylmethyl)-1,3-dimethyl-3aH-indol-1-ium-2-one is sourced from PubChem (CID 164670804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).