C14H26O5Si — CID 164670887
(2R,8R)-4,4-diethyl-8-methoxy-11,11-dimethyl-3,7,10,12-tetraoxa-4-silatricyclo[7.3.0.02,6]dodecane (PubChem CID 164670887) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is (2R,8R)-4,4-diethyl-8-methoxy-11,11-dimethyl-3,7,10,12-tetraoxa-4-silatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (2R,8R)-4,4-diethyl-8-methoxy-11,11-dimethyl-3,7,10,12-tetraoxa-4-silatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 164670887 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2R,8R)-4,4-diethyl-8-methoxy-11,11-dimethyl-3,7,10,12-tetraoxa-4-silatricyclo[7.3.0.02,6]dodecane |
| SMILES | CC[Si]1(CC)CC2O[C@@H](OC)C3OC(C)(C)OC3[C@H]2O1 |
| InChI | InChI=1S/C14H26O5Si/c1-6-20(7-2)8-9-10(19-20)11-12(13(15-5)16-9)18-14(3,4)17-11/h9-13H,6-8H2,1-5H3/t9?,10-,11?,12?,13+/m0/s1 |
| InChIKey | XHTOUMAJORGEPA-ZHYIQUJTSA-N |
| XLogP | 2.26 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|