C20H31NO4 — CID 164670933
tert-butyl (2S,3S)-2-amino-3-ethenyl-6-[(4-methoxyphenyl)methoxy]hexanoate (PubChem CID 164670933) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-amino-3-ethenyl-6-[(4-methoxyphenyl)methoxy]hexanoate.
| Compound Name | tert-butyl (2S,3S)-2-amino-3-ethenyl-6-[(4-methoxyphenyl)methoxy]hexanoate |
|---|---|
| PubChem CID | 164670933 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | tert-butyl (2S,3S)-2-amino-3-ethenyl-6-[(4-methoxyphenyl)methoxy]hexanoate |
| SMILES | C=C[C@H](CCCOCc1ccc(OC)cc1)[C@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO4/c1-6-16(18(21)19(22)25-20(2,3)4)8-7-13-24-14-15-9-11-17(23-5)12-10-15/h6,9-12,16,18H,1,7-8,13-14,21H2,2-5H3/t16-,18+/m1/s1 |
| InChIKey | KQYFUVJBGOQJQJ-AEFFLSMTSA-N |
| XLogP | 3.46 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|