About CID 164671001
CID 164671001 (PubChem CID 164671001) has the molecular formula C17H26Si
and a molecular weight of 258.48 g/mol.
Molecular Properties
| Compound Name | CID 164671001 |
| PubChem CID | 164671001 |
| Molecular Formula | C17H26Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | — |
| SMILES | C=CC(CCCCCCCC)[Si]c1ccccc1 |
| InChI | InChI=1S/C17H26Si/c1-3-5-6-7-8-10-13-16(4-2)18-17-14-11-9-12-15-17/h4,9,11-12,14-16H,2-3,5-8,10,13H2,1H3 |
| InChIKey | XXXXTJDMWBSLQA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 164671001 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164671001?
The IUPAC name of CID 164671001 (CID 164671001) is not available.
What is the SMILES notation for CID 164671001?
The canonical SMILES for CID 164671001 is C=CC(CCCCCCCC)[Si]c1ccccc1.
What is the InChIKey of CID 164671001?
The InChIKey is XXXXTJDMWBSLQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26Si/c1-3-5-6-7-8-10-13-16(4-2)18-17-14-11-9-12-15-17/h4,9,11-12,14-16H,2-3,5-8,10,13H2,1H3.
What are the key properties of CID 164671001?
CID 164671001 has a molecular weight of 258.48 g/mol, XLogP of 4.74, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164671001 is sourced from PubChem (CID 164671001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).