C26H29BN2O2 — CID 164671098
2-but-3-enyl-6-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinyl]pyridine (PubChem CID 164671098) has the molecular formula C26H29BN2O2 and a molecular weight of 412.34 g/mol. Its IUPAC name is 2-but-3-enyl-6-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinyl]pyridine.
| Compound Name | 2-but-3-enyl-6-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 164671098 |
| Molecular Formula | C26H29BN2O2 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 2-but-3-enyl-6-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-pyridinyl]pyridine |
| SMILES | C=CCCc1cccc(-c2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)cn2)n1 |
| InChI | InChI=1S/C26H29BN2O2/c1-6-7-9-22-10-8-11-24(29-22)23-17-14-20(18-28-23)19-12-15-21(16-13-19)27-30-25(2,3)26(4,5)31-27/h6,8,10-18H,1,7,9H2,2-5H3 |
| InChIKey | NAOOEYNXOXTROF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|