C20H32O5Si — CID 164671256
(4R,7R)-6-[[diethyl(phenyl)silyl]methyl]-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 164671256) has the molecular formula C20H32O5Si and a molecular weight of 380.56 g/mol. Its IUPAC name is (4R,7R)-6-[[diethyl(phenyl)silyl]methyl]-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (4R,7R)-6-[[diethyl(phenyl)silyl]methyl]-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 164671256 |
| Molecular Formula | C20H32O5Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (4R,7R)-6-[[diethyl(phenyl)silyl]methyl]-4-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CC[Si](CC)(CC1O[C@@H](OC)C2OC(C)(C)OC2[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H32O5Si/c1-6-26(7-2,14-11-9-8-10-12-14)13-15-16(21)17-18(19(22-5)23-15)25-20(3,4)24-17/h8-12,15-19,21H,6-7,13H2,1-5H3/t15?,16-,17?,18?,19+/m0/s1 |
| InChIKey | YKCPEYDHBLRIKN-POEJNWFMSA-N |
| XLogP | 2.63 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|