C8H16OS — CID 164671379
(3R,4S)-4-methyl-1-methylsulfanylhex-5-en-3-ol (PubChem CID 164671379) has the molecular formula C8H16OS and a molecular weight of 160.28 g/mol. Its IUPAC name is (3R,4S)-4-methyl-1-methylsulfanylhex-5-en-3-ol.
| Compound Name | (3R,4S)-4-methyl-1-methylsulfanylhex-5-en-3-ol |
|---|---|
| PubChem CID | 164671379 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (3R,4S)-4-methyl-1-methylsulfanylhex-5-en-3-ol |
| SMILES | C=C[C@H](C)[C@H](O)CCSC |
| InChI | InChI=1S/C8H16OS/c1-4-7(2)8(9)5-6-10-3/h4,7-9H,1,5-6H2,2-3H3/t7-,8+/m0/s1 |
| InChIKey | FJOYCOSJDHZAPT-JGVFFNPUSA-N |
| XLogP | 1.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|